About 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine
5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine (PubChem CID 170875437) has the molecular formula C11H11Cl2N5S
and a molecular weight of 316.22 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine |
| PubChem CID | 170875437 |
| Molecular Formula | C11H11Cl2N5S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(-c2cc(Cl)nc(Cl)c2)nc(N)c1CN |
| InChI | InChI=1S/C11H11Cl2N5S/c1-19-11-6(4-14)9(15)17-10(18-11)5-2-7(12)16-8(13)3-5/h2-3H,4,14H2,1H3,(H2,15,17,18) |
| InChIKey | YURDSFZOVXGVPB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine?
The IUPAC name of 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine (CID 170875437) is 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine.
What is the SMILES notation for 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine?
The canonical SMILES for 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine is CSc1nc(-c2cc(Cl)nc(Cl)c2)nc(N)c1CN.
What is the InChIKey of 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine?
The InChIKey is YURDSFZOVXGVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N5S/c1-19-11-6(4-14)9(15)17-10(18-11)5-2-7(12)16-8(13)3-5/h2-3H,4,14H2,1H3,(H2,15,17,18).
What are the key properties of 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine?
5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine has a molecular weight of 316.22 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-2-(2,6-dichloro-4-pyridinyl)-6-methylsulfanylpyrimidin-4-amine is sourced from PubChem (CID 170875437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).