C14H10ClN3OS2 — CID 170876618
(E)-3-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide (PubChem CID 170876618) has the molecular formula C14H10ClN3OS2 and a molecular weight of 335.84 g/mol. Its IUPAC name is (E)-3-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170876618 |
| Molecular Formula | C14H10ClN3OS2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (E)-3-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c(Sc2ccc(Cl)cc2)nc2sccn12 |
| InChI | InChI=1S/C14H10ClN3OS2/c15-9-1-3-10(4-2-9)21-13-11(5-6-12(16)19)18-7-8-20-14(18)17-13/h1-8H,(H2,16,19)/b6-5+ |
| InChIKey | VFLPKQQITGFNRD-AATRIKPKSA-N |
| XLogP | 3.70 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|