C15H11F2NO2 — CID 170876774
(Z)-3-[2-(3,4-difluorophenoxy)phenyl]prop-2-enamide (PubChem CID 170876774) has the molecular formula C15H11F2NO2 and a molecular weight of 275.25 g/mol. Its IUPAC name is (Z)-3-[2-(3,4-difluorophenoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[2-(3,4-difluorophenoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170876774 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (Z)-3-[2-(3,4-difluorophenoxy)phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C\c1ccccc1Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2NO2/c16-12-7-6-11(9-13(12)17)20-14-4-2-1-3-10(14)5-8-15(18)19/h1-9H,(H2,18,19)/b8-5- |
| InChIKey | GBRKFCRXGFOEAA-YVMONPNESA-N |
| XLogP | 3.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|