C14H14N2O3 — CID 170878117
(E)-3-(2,6-dimethoxyquinolin-3-yl)prop-2-enamide (PubChem CID 170878117) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (E)-3-(2,6-dimethoxyquinolin-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,6-dimethoxyquinolin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170878117 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (E)-3-(2,6-dimethoxyquinolin-3-yl)prop-2-enamide |
| SMILES | COc1ccc2nc(OC)c(/C=C/C(N)=O)cc2c1 |
| InChI | InChI=1S/C14H14N2O3/c1-18-11-4-5-12-10(8-11)7-9(3-6-13(15)17)14(16-12)19-2/h3-8H,1-2H3,(H2,15,17)/b6-3+ |
| InChIKey | PNADKZBGDRDCMJ-ZZXKWVIFSA-N |
| XLogP | 1.75 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|