C21H19F3N4O2 — CID 17087890
N-[1-cyclopentyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]pyridine-3-carboxamide (PubChem CID 17087890) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is N-[1-cyclopentyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-cyclopentyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17087890 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[1-cyclopentyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1(C(F)(F)F)N=C(c2ccccc2)N(C2CCCC2)C1=O)c1cccnc1 |
| InChI | InChI=1S/C21H19F3N4O2/c22-21(23,24)20(27-18(29)15-9-6-12-25-13-15)19(30)28(16-10-4-5-11-16)17(26-20)14-7-2-1-3-8-14/h1-3,6-9,12-13,16H,4-5,10-11H2,(H,27,29) |
| InChIKey | WYYNKCQZRRQUPW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |