C13H14F2N2 — CID 170879072
3-[1-(2,4-difluorophenyl)pyrrol-2-yl]propan-1-amine (PubChem CID 170879072) has the molecular formula C13H14F2N2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[1-(2,4-difluorophenyl)pyrrol-2-yl]propan-1-amine.
| Compound Name | 3-[1-(2,4-difluorophenyl)pyrrol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 170879072 |
| Molecular Formula | C13H14F2N2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-[1-(2,4-difluorophenyl)pyrrol-2-yl]propan-1-amine |
| SMILES | NCCCc1cccn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2/c14-10-5-6-13(12(15)9-10)17-8-2-4-11(17)3-1-7-16/h2,4-6,8-9H,1,3,7,16H2 |
| InChIKey | XHLOPJQOXZRGEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |