C21H21F3N2O7 — CID 170880590
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-nitro-2-[3-(trifluoromethyl)phenoxy]phenyl]propanoic acid (PubChem CID 170880590) has the molecular formula C21H21F3N2O7 and a molecular weight of 470.40 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-nitro-2-[3-(trifluoromethyl)phenoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-nitro-2-[3-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 170880590 |
| Molecular Formula | C21H21F3N2O7 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[5-nitro-2-[3-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc([N+](=O)[O-])ccc1Oc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C21H21F3N2O7/c1-20(2,3)33-19(29)25-16(18(27)28)10-12-9-14(26(30)31)7-8-17(12)32-15-6-4-5-13(11-15)21(22,23)24/h4-9,11,16H,10H2,1-3H3,(H,25,29)(H,27,28) |
| InChIKey | MGFIIIBAOZODIT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|