C18H20BrNO5 — CID 170880901
3-[5-(3-bromophenyl)furan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170880901) has the molecular formula C18H20BrNO5 and a molecular weight of 410.26 g/mol. Its IUPAC name is 3-[5-(3-bromophenyl)furan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[5-(3-bromophenyl)furan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170880901 |
| Molecular Formula | C18H20BrNO5 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 3-[5-(3-bromophenyl)furan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(-c2cccc(Br)c2)o1)C(=O)O |
| InChI | InChI=1S/C18H20BrNO5/c1-18(2,3)25-17(23)20-14(16(21)22)10-13-7-8-15(24-13)11-5-4-6-12(19)9-11/h4-9,14H,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | GMXOHOJWWZBATP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |