C31H27NO4 — CID 170882616
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-methylphenyl)phenyl]propanoic acid (PubChem CID 170882616) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-methylphenyl)phenyl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-methylphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170882616 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-methylphenyl)phenyl]propanoic acid |
| SMILES | Cc1ccc(-c2ccccc2CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C31H27NO4/c1-20-14-16-21(17-15-20)23-9-3-2-8-22(23)18-29(30(33)34)32-31(35)36-19-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28/h2-17,28-29H,18-19H2,1H3,(H,32,35)(H,33,34) |
| InChIKey | ZESAWIIXOQWSTA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |