C30H26N2O5 — CID 170883054
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(pyridin-2-ylmethoxy)phenyl]propanoic acid (PubChem CID 170883054) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(pyridin-2-ylmethoxy)phenyl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(pyridin-2-ylmethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170883054 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(pyridin-2-ylmethoxy)phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1cccc(OCc2ccccn2)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H26N2O5/c33-29(34)28(17-20-8-7-10-22(16-20)36-18-21-9-5-6-15-31-21)32-30(35)37-19-27-25-13-3-1-11-23(25)24-12-2-4-14-26(24)27/h1-16,27-28H,17-19H2,(H,32,35)(H,33,34) |
| InChIKey | NUJGOMKDZCQTCX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |