C21H22ClN5O2S — CID 17088408
6-(3-chloro-4-methoxyphenyl)-3-ethyl-N-(3-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 17088408) has the molecular formula C21H22ClN5O2S and a molecular weight of 443.96 g/mol. Its IUPAC name is 6-(3-chloro-4-methoxyphenyl)-3-ethyl-N-(3-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | 6-(3-chloro-4-methoxyphenyl)-3-ethyl-N-(3-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 17088408 |
| Molecular Formula | C21H22ClN5O2S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 6-(3-chloro-4-methoxyphenyl)-3-ethyl-N-(3-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCc1nnc2n1NC(c1ccc(OC)c(Cl)c1)C(C(=O)Nc1cccc(C)c1)S2 |
| InChI | InChI=1S/C21H22ClN5O2S/c1-4-17-24-25-21-27(17)26-18(13-8-9-16(29-3)15(22)11-13)19(30-21)20(28)23-14-7-5-6-12(2)10-14/h5-11,18-19,26H,4H2,1-3H3,(H,23,28) |
| InChIKey | ISIDTWMTQMWPBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |