About 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid
2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid (PubChem CID 170886697) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid |
| PubChem CID | 170886697 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1CC1OCCO1 |
| InChI | InChI=1S/C12H14O4/c13-11(14)7-9-3-1-2-4-10(9)8-12-15-5-6-16-12/h1-4,12H,5-8H2,(H,13,14) |
| InChIKey | ZVXGKGCMOCDJKP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid?
The IUPAC name of 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid (CID 170886697) is 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid.
What is the SMILES notation for 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid?
The canonical SMILES for 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid is O=C(O)Cc1ccccc1CC1OCCO1.
What is the InChIKey of 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid?
The InChIKey is ZVXGKGCMOCDJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c13-11(14)7-9-3-1-2-4-10(9)8-12-15-5-6-16-12/h1-4,12H,5-8H2,(H,13,14).
What are the key properties of 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid?
2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid has a molecular weight of 222.24 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dioxolan-2-ylmethyl)phenyl]acetic acid is sourced from PubChem (CID 170886697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).