C21H26N2O4 — CID 170887151
3-[2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenylpyrrol-3-yl]-3-oxopropanoic acid (PubChem CID 170887151) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenylpyrrol-3-yl]-3-oxopropanoic acid.
| Compound Name | 3-[2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenylpyrrol-3-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 170887151 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenylpyrrol-3-yl]-3-oxopropanoic acid |
| SMILES | Cc1c(C(=O)CC(=O)O)cc(-c2ccccc2)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C21H26N2O4/c1-16-18(20(24)15-21(25)26)14-19(17-6-3-2-4-7-17)23(16)9-5-8-22-10-12-27-13-11-22/h2-4,6-7,14H,5,8-13,15H2,1H3,(H,25,26) |
| InChIKey | HJPZDRBFGMNFKN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|