About N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide
N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide (PubChem CID 17088867) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide |
| PubChem CID | 17088867 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1c(C#N)c(C)nn1C |
| InChI | InChI=1S/C15H16N4O3/c1-9-10(8-16)14(19(2)18-9)17-15(20)13-11(21-3)6-5-7-12(13)22-4/h5-7H,1-4H3,(H,17,20) |
| InChIKey | BMYURQDFPUTOED-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide?
The IUPAC name of N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide (CID 17088867) is N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide.
What is the SMILES notation for N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide?
The canonical SMILES for N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide is COc1cccc(OC)c1C(=O)Nc1c(C#N)c(C)nn1C.
What is the InChIKey of N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide?
The InChIKey is BMYURQDFPUTOED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-9-10(8-16)14(19(2)18-9)17-15(20)13-11(21-3)6-5-7-12(13)22-4/h5-7H,1-4H3,(H,17,20).
What are the key properties of N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide?
N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide has a molecular weight of 300.32 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-1,3-dimethylpyrazol-5-yl)-2,6-dimethoxybenzamide is sourced from PubChem (CID 17088867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).