About 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride
2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride (PubChem CID 170889153) has the molecular formula C18H34Cl2N2O
and a molecular weight of 365.39 g/mol. Its IUPAC name is 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride.
Molecular Properties
| Compound Name | 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride |
| PubChem CID | 170889153 |
| Molecular Formula | C18H34Cl2N2O |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride |
| SMILES | CCC(N)Cc1cc(C(C)(C)C)cc(CC(N)CC)c1O.Cl.Cl |
| InChI | InChI=1S/C18H32N2O.2ClH/c1-6-15(19)10-12-8-14(18(3,4)5)9-13(17(12)21)11-16(20)7-2;;/h8-9,15-16,21H,6-7,10-11,19-20H2,1-5H3;2*1H |
| InChIKey | GYWBRZDEADXOSP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride?
The IUPAC name of 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride (CID 170889153) is 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride.
What is the SMILES notation for 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride?
The canonical SMILES for 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride is CCC(N)Cc1cc(C(C)(C)C)cc(CC(N)CC)c1O.Cl.Cl.
What is the InChIKey of 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride?
The InChIKey is GYWBRZDEADXOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O.2ClH/c1-6-15(19)10-12-8-14(18(3,4)5)9-13(17(12)21)11-16(20)7-2;;/h8-9,15-16,21H,6-7,10-11,19-20H2,1-5H3;2*1H.
What are the key properties of 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride?
2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride has a molecular weight of 365.39 g/mol, XLogP of 4.09, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2-aminobutyl)-4-tert-butylphenol;dihydrochloride is sourced from PubChem (CID 170889153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).