C26H33FN6O — CID 17088965
1-(1-adamantyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]urea (PubChem CID 17088965) has the molecular formula C26H33FN6O and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 17088965 |
| Molecular Formula | C26H33FN6O |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-(1-adamantyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(N/C(=N\CCc2ccc(F)cc2)NC(=O)NC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C26H33FN6O/c1-16-9-17(2)30-24(29-16)31-23(28-8-7-18-3-5-22(27)6-4-18)32-25(34)33-26-13-19-10-20(14-26)12-21(11-19)15-26/h3-6,9,19-21H,7-8,10-15H2,1-2H3,(H3,28,29,30,31,32,33,34) |
| InChIKey | DCIFOKRQQQAPGU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|