C15H28Cl2N2 — CID 170889803
4-(3-methylphenyl)octane-2,6-diamine;dihydrochloride (PubChem CID 170889803) has the molecular formula C15H28Cl2N2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-(3-methylphenyl)octane-2,6-diamine;dihydrochloride.
| Compound Name | 4-(3-methylphenyl)octane-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 170889803 |
| Molecular Formula | C15H28Cl2N2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-(3-methylphenyl)octane-2,6-diamine;dihydrochloride |
| SMILES | CCC(N)CC(CC(C)N)c1cccc(C)c1.Cl.Cl |
| InChI | InChI=1S/C15H26N2.2ClH/c1-4-15(17)10-14(9-12(3)16)13-7-5-6-11(2)8-13;;/h5-8,12,14-15H,4,9-10,16-17H2,1-3H3;2*1H |
| InChIKey | YMJQPIIQWPXCHL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |