About 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride
3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride (PubChem CID 170893800) has the molecular formula C17H23ClN2O2
and a molecular weight of 322.84 g/mol. Its IUPAC name is 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride |
| PubChem CID | 170893800 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride |
| SMILES | Cc1c(C(=O)O)cccc1-n1c(C)cc(CC(C)N)c1C.Cl |
| InChI | InChI=1S/C17H22N2O2.ClH/c1-10(18)8-14-9-11(2)19(13(14)4)16-7-5-6-15(12(16)3)17(20)21;/h5-7,9-10H,8,18H2,1-4H3,(H,20,21);1H |
| InChIKey | DSLNZCOHZIZGSO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride?
The IUPAC name of 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride (CID 170893800) is 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride.
What is the SMILES notation for 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride?
The canonical SMILES for 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride is Cc1c(C(=O)O)cccc1-n1c(C)cc(CC(C)N)c1C.Cl.
What is the InChIKey of 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride?
The InChIKey is DSLNZCOHZIZGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2.ClH/c1-10(18)8-14-9-11(2)19(13(14)4)16-7-5-6-15(12(16)3)17(20)21;/h5-7,9-10H,8,18H2,1-4H3,(H,20,21);1H.
What are the key properties of 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride?
3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride has a molecular weight of 322.84 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminopropyl)-2,5-dimethylpyrrol-1-yl]-2-methylbenzoic acid;hydrochloride is sourced from PubChem (CID 170893800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).