C14H19NO3 — CID 170896207
1-(3,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(dimethylamino)ethanone (PubChem CID 170896207) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(dimethylamino)ethanone.
| Compound Name | 1-(3,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 170896207 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-(3,4-dihydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)c1cc2c(c(O)c1O)CCCC2 |
| InChI | InChI=1S/C14H19NO3/c1-15(2)8-12(16)11-7-9-5-3-4-6-10(9)13(17)14(11)18/h7,17-18H,3-6,8H2,1-2H3 |
| InChIKey | BUHHDXMIMHOVGQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|