C17H16ClFN2O3 — CID 170896293
(2-chloro-4-fluorophenyl) N-[3-[2-(dimethylamino)acetyl]phenyl]carbamate (PubChem CID 170896293) has the molecular formula C17H16ClFN2O3 and a molecular weight of 350.78 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl) N-[3-[2-(dimethylamino)acetyl]phenyl]carbamate.
| Compound Name | (2-chloro-4-fluorophenyl) N-[3-[2-(dimethylamino)acetyl]phenyl]carbamate |
|---|---|
| PubChem CID | 170896293 |
| Molecular Formula | C17H16ClFN2O3 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2-chloro-4-fluorophenyl) N-[3-[2-(dimethylamino)acetyl]phenyl]carbamate |
| SMILES | CN(C)CC(=O)c1cccc(NC(=O)Oc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C17H16ClFN2O3/c1-21(2)10-15(22)11-4-3-5-13(8-11)20-17(23)24-16-7-6-12(19)9-14(16)18/h3-9H,10H2,1-2H3,(H,20,23) |
| InChIKey | NAZJKBHBYWEYIU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |