C10H2Br2N2S2Se — CID 170896753
9,14-dibromo-10,13-dithia-4-selena-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene (PubChem CID 170896753) has the molecular formula C10H2Br2N2S2Se and a molecular weight of 453.04 g/mol. Its IUPAC name is 9,14-dibromo-10,13-dithia-4-selena-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene.
| Compound Name | 9,14-dibromo-10,13-dithia-4-selena-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene |
|---|---|
| PubChem CID | 170896753 |
| Molecular Formula | C10H2Br2N2S2Se |
| Molecular Weight | 453.04 g/mol |
| Exact Mass | 451.72 |
| IUPAC Name | 9,14-dibromo-10,13-dithia-4-selena-3,5-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene |
| SMILES | Brc1cc2c3n[se]nc3c3cc(Br)sc3c2s1 |
| InChI | InChI=1S/C10H2Br2N2S2Se/c11-5-1-3-7-8(14-17-13-7)4-2-6(12)16-10(4)9(3)15-5/h1-2H |
| InChIKey | WNUNROKCXPGTEJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.04 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|