About (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride
(1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride (PubChem CID 170898010) has the molecular formula C5H8ClF2NO
and a molecular weight of 171.57 g/mol. Its IUPAC name is (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride.
Molecular Properties
| Compound Name | (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride |
| PubChem CID | 170898010 |
| Molecular Formula | C5H8ClF2NO |
| Molecular Weight | 171.57 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride |
| SMILES | Cl.FC1(F)[C@@H]2NCCO[C@H]21 |
| InChI | InChI=1S/C5H7F2NO.ClH/c6-5(7)3-4(5)9-2-1-8-3;/h3-4,8H,1-2H2;1H/t3-,4-;/m1./s1 |
| InChIKey | YNOFUUUOBHBDMF-VKKIDBQXSA-N |
| XLogP | 0.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.57 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride?
The IUPAC name of (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride (CID 170898010) is (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride.
What is the SMILES notation for (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride?
The canonical SMILES for (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride is Cl.FC1(F)[C@@H]2NCCO[C@H]21.
What is the InChIKey of (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride?
The InChIKey is YNOFUUUOBHBDMF-VKKIDBQXSA-N. The full InChI is InChI=1S/C5H7F2NO.ClH/c6-5(7)3-4(5)9-2-1-8-3;/h3-4,8H,1-2H2;1H/t3-,4-;/m1./s1.
What are the key properties of (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride?
(1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride has a molecular weight of 171.57 g/mol, XLogP of 0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6R)-7,7-difluoro-2-oxa-5-azabicyclo[4.1.0]heptane;hydrochloride is sourced from PubChem (CID 170898010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).