About [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid
[4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid (PubChem CID 170898459) has the molecular formula C22H19BN2O6
and a molecular weight of 418.21 g/mol. Its IUPAC name is [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid |
| PubChem CID | 170898459 |
| Molecular Formula | C22H19BN2O6 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid |
| SMILES | CCN1C(=O)c2cccc3c(NC(=O)OCc4ccc(B(O)O)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C22H19BN2O6/c1-2-25-20(26)16-5-3-4-15-18(11-10-17(19(15)16)21(25)27)24-22(28)31-12-13-6-8-14(9-7-13)23(29)30/h3-11,29-30H,2,12H2,1H3,(H,24,28) |
| InChIKey | CBPBQIMJLBARTQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid?
The IUPAC name of [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid (CID 170898459) is [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid.
What is the SMILES notation for [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid?
The canonical SMILES for [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid is CCN1C(=O)c2cccc3c(NC(=O)OCc4ccc(B(O)O)cc4)ccc(c23)C1=O.
What is the InChIKey of [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid?
The InChIKey is CBPBQIMJLBARTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19BN2O6/c1-2-25-20(26)16-5-3-4-15-18(11-10-17(19(15)16)21(25)27)24-22(28)31-12-13-6-8-14(9-7-13)23(29)30/h3-11,29-30H,2,12H2,1H3,(H,24,28).
What are the key properties of [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid?
[4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid has a molecular weight of 418.21 g/mol, XLogP of 1.88, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-ethyl-1,3-dioxobenzo[de]isoquinolin-6-yl)carbamoyloxymethyl]phenyl]boronic acid is sourced from PubChem (CID 170898459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).