C22H46B2O5Si — CID 170898638
[(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]-tert-butyl-dimethylsilane (PubChem CID 170898638) has the molecular formula C22H46B2O5Si and a molecular weight of 440.32 g/mol. Its IUPAC name is [(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 170898638 |
| Molecular Formula | C22H46B2O5Si |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | [(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1(C)OB(C[C@H](CCO[Si](C)(C)C(C)(C)C)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C22H46B2O5Si/c1-18(2,3)30(12,13)25-15-14-17(24-28-21(8,9)22(10,11)29-24)16-23-26-19(4,5)20(6,7)27-23/h17H,14-16H2,1-13H3/t17-/m0/s1 |
| InChIKey | JMSDYTVRXILKGE-KRWDZBQOSA-N |
| XLogP | 5.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|