C12H10O7 — CID 170899509
2-(2,3,5-trihydroxyphenoxy)benzene-1,3,5-triol (PubChem CID 170899509) has the molecular formula C12H10O7 and a molecular weight of 266.20 g/mol. Its IUPAC name is 2-(2,3,5-trihydroxyphenoxy)benzene-1,3,5-triol.
| Compound Name | 2-(2,3,5-trihydroxyphenoxy)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 170899509 |
| Molecular Formula | C12H10O7 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-(2,3,5-trihydroxyphenoxy)benzene-1,3,5-triol |
| SMILES | Oc1cc(O)c(Oc2cc(O)cc(O)c2O)c(O)c1 |
| InChI | InChI=1S/C12H10O7/c13-5-2-8(16)12(9(17)3-5)19-10-4-6(14)1-7(15)11(10)18/h1-4,13-18H |
| InChIKey | ILQGFPYRUYPAPC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|