About (3-chloro-4,5-dihydroxyphenyl)boronic acid
(3-chloro-4,5-dihydroxyphenyl)boronic acid (PubChem CID 170900072) has the molecular formula C6H6BClO4
and a molecular weight of 188.37 g/mol. Its IUPAC name is (3-chloro-4,5-dihydroxyphenyl)boronic acid.
Molecular Properties
| Compound Name | (3-chloro-4,5-dihydroxyphenyl)boronic acid |
| PubChem CID | 170900072 |
| Molecular Formula | C6H6BClO4 |
| Molecular Weight | 188.37 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | (3-chloro-4,5-dihydroxyphenyl)boronic acid |
| SMILES | OB(O)c1cc(O)c(O)c(Cl)c1 |
| InChI | InChI=1S/C6H6BClO4/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,9-12H |
| InChIKey | STLNVSBEESBJCV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.37 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4,5-dihydroxyphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4,5-dihydroxyphenyl)boronic acid?
The IUPAC name of (3-chloro-4,5-dihydroxyphenyl)boronic acid (CID 170900072) is (3-chloro-4,5-dihydroxyphenyl)boronic acid.
What is the SMILES notation for (3-chloro-4,5-dihydroxyphenyl)boronic acid?
The canonical SMILES for (3-chloro-4,5-dihydroxyphenyl)boronic acid is OB(O)c1cc(O)c(O)c(Cl)c1.
What is the InChIKey of (3-chloro-4,5-dihydroxyphenyl)boronic acid?
The InChIKey is STLNVSBEESBJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BClO4/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,9-12H.
What are the key properties of (3-chloro-4,5-dihydroxyphenyl)boronic acid?
(3-chloro-4,5-dihydroxyphenyl)boronic acid has a molecular weight of 188.37 g/mol, XLogP of -0.57, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4,5-dihydroxyphenyl)boronic acid is sourced from PubChem (CID 170900072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).