C17H34B2O5 — CID 170900106
(2R,4S)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol (PubChem CID 170900106) has the molecular formula C17H34B2O5 and a molecular weight of 340.08 g/mol. Its IUPAC name is (2R,4S)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol.
| Compound Name | (2R,4S)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 170900106 |
| Molecular Formula | C17H34B2O5 |
| Molecular Weight | 340.08 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (2R,4S)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol |
| SMILES | C[C@@H](O)C[C@H](CB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H34B2O5/c1-12(20)10-13(19-23-16(6,7)17(8,9)24-19)11-18-21-14(2,3)15(4,5)22-18/h12-13,20H,10-11H2,1-9H3/t12-,13-/m1/s1 |
| InChIKey | RSHMZPUBNXWFJX-CHWSQXEVSA-N |
| XLogP | 3.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|