C8H6Br2N2O2S2Se — CID 170900935
4,7-dibromo-5,6-bis(methylsulfinyl)-2,1,3-benzoselenadiazole (PubChem CID 170900935) has the molecular formula C8H6Br2N2O2S2Se and a molecular weight of 465.05 g/mol. Its IUPAC name is 4,7-dibromo-5,6-bis(methylsulfinyl)-2,1,3-benzoselenadiazole.
| Compound Name | 4,7-dibromo-5,6-bis(methylsulfinyl)-2,1,3-benzoselenadiazole |
|---|---|
| PubChem CID | 170900935 |
| Molecular Formula | C8H6Br2N2O2S2Se |
| Molecular Weight | 465.05 g/mol |
| Exact Mass | 463.74 |
| IUPAC Name | 4,7-dibromo-5,6-bis(methylsulfinyl)-2,1,3-benzoselenadiazole |
| SMILES | CS(=O)c1c(S(C)=O)c(Br)c2n[se]nc2c1Br |
| InChI | InChI=1S/C8H6Br2N2O2S2Se/c1-15(13)7-3(9)5-6(12-17-11-5)4(10)8(7)16(2)14/h1-2H3 |
| InChIKey | OHTKBSJESUEFDY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.05 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|