C26H14O4S4 — CID 170901047
5-[2,4,5-tris(5-formylthiophen-2-yl)phenyl]thiophene-2-carbaldehyde (PubChem CID 170901047) has the molecular formula C26H14O4S4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 5-[2,4,5-tris(5-formylthiophen-2-yl)phenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2,4,5-tris(5-formylthiophen-2-yl)phenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 170901047 |
| Molecular Formula | C26H14O4S4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 5-[2,4,5-tris(5-formylthiophen-2-yl)phenyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(-c3ccc(C=O)s3)c(-c3ccc(C=O)s3)cc2-c2ccc(C=O)s2)s1 |
| InChI | InChI=1S/C26H14O4S4/c27-11-15-1-5-23(31-15)19-9-21(25-7-3-17(13-29)33-25)22(26-8-4-18(14-30)34-26)10-20(19)24-6-2-16(12-28)32-24/h1-14H |
| InChIKey | DLYJFWXBWUPMRK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|