C25H25F12N4O11PS4 — CID 170901094
bis(bis(trifluoromethylsulfonyl)azanide);2-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid (PubChem CID 170901094) has the molecular formula C25H25F12N4O11PS4 and a molecular weight of 944.71 g/mol. Its IUPAC name is bis(bis(trifluoromethylsulfonyl)azanide);2-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid.
| Compound Name | bis(bis(trifluoromethylsulfonyl)azanide);2-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 170901094 |
| Molecular Formula | C25H25F12N4O11PS4 |
| Molecular Weight | 944.71 g/mol |
| Exact Mass | 943.99 |
| IUPAC Name | bis(bis(trifluoromethylsulfonyl)azanide);2-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid |
| SMILES | Cc1cc(C)c(-[n+]2ccc(-c3cc[n+](CCP(=O)(O)O)cc3)cc2)c(C)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H23N2O3P.2C2F6NO4S2/c1-16-14-17(2)21(18(3)15-16)23-10-6-20(7-11-23)19-4-8-22(9-5-19)12-13-27(24,25)26;2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-11,14-15H,12-13H2,1-3H3;;/q;2*-1/p+2 |
| InChIKey | PKDBMCIASBRPNN-UHFFFAOYSA-P |
| XLogP | 5.14 |
| TPSA | 230.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|