About methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate
methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate (PubChem CID 170901196) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate |
| PubChem CID | 170901196 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=CC1C(O)CO |
| InChI | InChI=1S/C9H14O4/c1-13-9(12)7-4-2-3-6(7)8(11)5-10/h2-3,6-8,10-11H,4-5H2,1H3 |
| InChIKey | BRYWHRHTIKLUNW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate?
The IUPAC name of methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate (CID 170901196) is methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate.
What is the SMILES notation for methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate?
The canonical SMILES for methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate is COC(=O)C1CC=CC1C(O)CO.
What is the InChIKey of methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate?
The InChIKey is BRYWHRHTIKLUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-13-9(12)7-4-2-3-6(7)8(11)5-10/h2-3,6-8,10-11H,4-5H2,1H3.
What are the key properties of methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate?
methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate has a molecular weight of 186.21 g/mol, XLogP of -0.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,2-dihydroxyethyl)cyclopent-3-ene-1-carboxylate is sourced from PubChem (CID 170901196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).