About 3-butylnonanoyl chloride
3-butylnonanoyl chloride (PubChem CID 170901322) has the molecular formula C13H25ClO
and a molecular weight of 232.79 g/mol. Its IUPAC name is 3-butylnonanoyl chloride.
Molecular Properties
| Compound Name | 3-butylnonanoyl chloride |
| PubChem CID | 170901322 |
| Molecular Formula | C13H25ClO |
| Molecular Weight | 232.79 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-butylnonanoyl chloride |
| SMILES | CCCCCCC(CCCC)CC(=O)Cl |
| InChI | InChI=1S/C13H25ClO/c1-3-5-7-8-10-12(9-6-4-2)11-13(14)15/h12H,3-11H2,1-2H3 |
| InChIKey | XBENFRPEKROFBJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butylnonanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylnonanoyl chloride?
The IUPAC name of 3-butylnonanoyl chloride (CID 170901322) is 3-butylnonanoyl chloride.
What is the SMILES notation for 3-butylnonanoyl chloride?
The canonical SMILES for 3-butylnonanoyl chloride is CCCCCCC(CCCC)CC(=O)Cl.
What is the InChIKey of 3-butylnonanoyl chloride?
The InChIKey is XBENFRPEKROFBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25ClO/c1-3-5-7-8-10-12(9-6-4-2)11-13(14)15/h12H,3-11H2,1-2H3.
What are the key properties of 3-butylnonanoyl chloride?
3-butylnonanoyl chloride has a molecular weight of 232.79 g/mol, XLogP of 4.92, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylnonanoyl chloride is sourced from PubChem (CID 170901322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).