About 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine
2-bromo-[1,2,4]triazolo[1,5-b]pyridazine (PubChem CID 170901694) has the molecular formula C5H3BrN4
and a molecular weight of 199.01 g/mol. Its IUPAC name is 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine |
| PubChem CID | 170901694 |
| Molecular Formula | C5H3BrN4 |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine |
| SMILES | Brc1nc2cccnn2n1 |
| InChI | InChI=1S/C5H3BrN4/c6-5-8-4-2-1-3-7-10(4)9-5/h1-3H |
| InChIKey | WWDJZCKLVFGXDA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine?
The IUPAC name of 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine (CID 170901694) is 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine.
What is the SMILES notation for 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine?
The canonical SMILES for 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine is Brc1nc2cccnn2n1.
What is the InChIKey of 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine?
The InChIKey is WWDJZCKLVFGXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrN4/c6-5-8-4-2-1-3-7-10(4)9-5/h1-3H.
What are the key properties of 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine?
2-bromo-[1,2,4]triazolo[1,5-b]pyridazine has a molecular weight of 199.01 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-[1,2,4]triazolo[1,5-b]pyridazine is sourced from PubChem (CID 170901694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).