C10H16ClNO3 — CID 170902495
methyl (1S,3aR,4S,7R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylate;hydrochloride (PubChem CID 170902495) has the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. Its IUPAC name is methyl (1S,3aR,4S,7R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylate;hydrochloride.
| Compound Name | methyl (1S,3aR,4S,7R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 170902495 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | methyl (1S,3aR,4S,7R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@H]1NC[C@H]2[C@@H]1[C@H]1CC[C@@H]2O1.Cl |
| InChI | InChI=1S/C10H15NO3.ClH/c1-13-10(12)9-8-5(4-11-9)6-2-3-7(8)14-6;/h5-9,11H,2-4H2,1H3;1H/t5-,6+,7-,8-,9+;/m1./s1 |
| InChIKey | GJGXQUMCOFXFSZ-CXZWTDGCSA-N |
| XLogP | 0.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |