C27H25BO3 — CID 170902506
4,4,5,5-tetramethyl-2-(8-methyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl)-1,3,2-dioxaborolane (PubChem CID 170902506) has the molecular formula C27H25BO3 and a molecular weight of 408.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(8-methyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(8-methyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170902506 |
| Molecular Formula | C27H25BO3 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(8-methyl-3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-5-yl)-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)c2oc3c(ccc4ccc5ccccc5c43)c12 |
| InChI | InChI=1S/C27H25BO3/c1-16-10-15-21(28-30-26(2,3)27(4,5)31-28)25-22(16)20-14-13-18-12-11-17-8-6-7-9-19(17)23(18)24(20)29-25/h6-15H,1-5H3 |
| InChIKey | VBIVGDITECKYSJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|