About 2-bromo-6,8-dimethoxyindolizine
2-bromo-6,8-dimethoxyindolizine (PubChem CID 170902805) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is 2-bromo-6,8-dimethoxyindolizine.
Molecular Properties
| Compound Name | 2-bromo-6,8-dimethoxyindolizine |
| PubChem CID | 170902805 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-bromo-6,8-dimethoxyindolizine |
| SMILES | COc1cc(OC)c2cc(Br)cn2c1 |
| InChI | InChI=1S/C10H10BrNO2/c1-13-8-4-10(14-2)9-3-7(11)5-12(9)6-8/h3-6H,1-2H3 |
| InChIKey | NHUHJSRATMLVKI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 22.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-6,8-dimethoxyindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6,8-dimethoxyindolizine?
The IUPAC name of 2-bromo-6,8-dimethoxyindolizine (CID 170902805) is 2-bromo-6,8-dimethoxyindolizine.
What is the SMILES notation for 2-bromo-6,8-dimethoxyindolizine?
The canonical SMILES for 2-bromo-6,8-dimethoxyindolizine is COc1cc(OC)c2cc(Br)cn2c1.
What is the InChIKey of 2-bromo-6,8-dimethoxyindolizine?
The InChIKey is NHUHJSRATMLVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2/c1-13-8-4-10(14-2)9-3-7(11)5-12(9)6-8/h3-6H,1-2H3.
What are the key properties of 2-bromo-6,8-dimethoxyindolizine?
2-bromo-6,8-dimethoxyindolizine has a molecular weight of 256.10 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6,8-dimethoxyindolizine is sourced from PubChem (CID 170902805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).