About 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide
4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide (PubChem CID 170904373) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide |
| PubChem CID | 170904373 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide |
| SMILES | Cn1ncc2ccc(C3CCS(=O)(=O)CC3)nc21 |
| InChI | InChI=1S/C12H15N3O2S/c1-15-12-10(8-13-15)2-3-11(14-12)9-4-6-18(16,17)7-5-9/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | AKYDXLXANTZTSA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide?
The IUPAC name of 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide (CID 170904373) is 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide.
What is the SMILES notation for 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide?
The canonical SMILES for 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide is Cn1ncc2ccc(C3CCS(=O)(=O)CC3)nc21.
What is the InChIKey of 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide?
The InChIKey is AKYDXLXANTZTSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-15-12-10(8-13-15)2-3-11(14-12)9-4-6-18(16,17)7-5-9/h2-3,8-9H,4-7H2,1H3.
What are the key properties of 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide?
4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide has a molecular weight of 265.34 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylpyrazolo[5,4-b]pyridin-6-yl)thiane 1,1-dioxide is sourced from PubChem (CID 170904373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).