About 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine
3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine (PubChem CID 170904448) has the molecular formula C8H8BrN3
and a molecular weight of 226.08 g/mol. Its IUPAC name is 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 170904448 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine |
| SMILES | Cc1cc2c(Br)[nH]nc2nc1C |
| InChI | InChI=1S/C8H8BrN3/c1-4-3-6-7(9)11-12-8(6)10-5(4)2/h3H,1-2H3,(H,10,11,12) |
| InChIKey | HCIPEUSAQNHSTJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine (CID 170904448) is 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine is Cc1cc2c(Br)[nH]nc2nc1C.
What is the InChIKey of 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is HCIPEUSAQNHSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3/c1-4-3-6-7(9)11-12-8(6)10-5(4)2/h3H,1-2H3,(H,10,11,12).
What are the key properties of 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine?
3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 226.08 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6-dimethyl-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 170904448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).