C14H22N2O3 — CID 170904619
tert-butyl (4R)-4-(1,3-oxazol-5-yl)azepane-1-carboxylate (PubChem CID 170904619) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl (4R)-4-(1,3-oxazol-5-yl)azepane-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-(1,3-oxazol-5-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 170904619 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | tert-butyl (4R)-4-(1,3-oxazol-5-yl)azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](c2cnco2)CC1 |
| InChI | InChI=1S/C14H22N2O3/c1-14(2,3)19-13(17)16-7-4-5-11(6-8-16)12-9-15-10-18-12/h9-11H,4-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | XVWNLUPWPJVHID-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |