About 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol
3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol (PubChem CID 170904687) has the molecular formula C8H9F3N2O
and a molecular weight of 206.17 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol |
| PubChem CID | 170904687 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol |
| SMILES | Oc1cn(CC(F)(F)F)nc1C1CC1 |
| InChI | InChI=1S/C8H9F3N2O/c9-8(10,11)4-13-3-6(14)7(12-13)5-1-2-5/h3,5,14H,1-2,4H2 |
| InChIKey | PUCMZAYQLAWDEK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol?
The IUPAC name of 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol (CID 170904687) is 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol.
What is the SMILES notation for 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol?
The canonical SMILES for 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol is Oc1cn(CC(F)(F)F)nc1C1CC1.
What is the InChIKey of 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol?
The InChIKey is PUCMZAYQLAWDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O/c9-8(10,11)4-13-3-6(14)7(12-13)5-1-2-5/h3,5,14H,1-2,4H2.
What are the key properties of 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol?
3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol has a molecular weight of 206.17 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-ol is sourced from PubChem (CID 170904687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).