C6H10O8S — CID 170905335
deuterio [(2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methanesulfonate (PubChem CID 170905335) has the molecular formula C6H10O8S and a molecular weight of 243.21 g/mol. Its IUPAC name is deuterio [(2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methanesulfonate.
| Compound Name | deuterio [(2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 170905335 |
| Molecular Formula | C6H10O8S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | deuterio [(2S,3S,4S,5R)-3,4,5-trihydroxy-6-oxooxan-2-yl]methanesulfonate |
| SMILES | [2H]OS(=O)(=O)C[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O8S/c7-3-2(1-15(11,12)13)14-6(10)5(9)4(3)8/h2-5,7-9H,1H2,(H,11,12,13)/t2-,3-,4+,5-/m1/s1/i/hD |
| InChIKey | YOMAOVCVRGQULE-ZJMMEKQKSA-N |
| XLogP | -3.12 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|