C10H16BrNO2 — CID 170905475
7-bromo-5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (PubChem CID 170905475) has the molecular formula C10H16BrNO2 and a molecular weight of 262.15 g/mol. Its IUPAC name is 7-bromo-5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid.
| Compound Name | 7-bromo-5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170905475 |
| Molecular Formula | C10H16BrNO2 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 7-bromo-5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| SMILES | CC1CC(Br)C2NC(C(=O)O)CC2C1 |
| InChI | InChI=1S/C10H16BrNO2/c1-5-2-6-4-8(10(13)14)12-9(6)7(11)3-5/h5-9,12H,2-4H2,1H3,(H,13,14) |
| InChIKey | WXRPLGZSWNAOAE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|