C12H23FN2 — CID 170905499
2-(4-fluoro-2,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethanamine (PubChem CID 170905499) has the molecular formula C12H23FN2 and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-(4-fluoro-2,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(4-fluoro-2,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 170905499 |
| Molecular Formula | C12H23FN2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-(4-fluoro-2,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethanamine |
| SMILES | CC1CCC(F)C2C(CCN)C(C)NC12 |
| InChI | InChI=1S/C12H23FN2/c1-7-3-4-10(13)11-9(5-6-14)8(2)15-12(7)11/h7-12,15H,3-6,14H2,1-2H3 |
| InChIKey | YQHNUJQEBQBLBN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |