C9H16N2O2 — CID 170905504
5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole-2-carboxylic acid (PubChem CID 170905504) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole-2-carboxylic acid.
| Compound Name | 5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 170905504 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole-2-carboxylic acid |
| SMILES | CC1CCC2NC(C(=O)O)NC2C1 |
| InChI | InChI=1S/C9H16N2O2/c1-5-2-3-6-7(4-5)11-8(10-6)9(12)13/h5-8,10-11H,2-4H2,1H3,(H,12,13) |
| InChIKey | DHBSGUBKRLDJLA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |