C6H9Cl4N3 — CID 170906085
4,5,6,7-tetrachloro-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole (PubChem CID 170906085) has the molecular formula C6H9Cl4N3 and a molecular weight of 264.97 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole.
| Compound Name | 4,5,6,7-tetrachloro-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole |
|---|---|
| PubChem CID | 170906085 |
| Molecular Formula | C6H9Cl4N3 |
| Molecular Weight | 264.97 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 4,5,6,7-tetrachloro-2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole |
| SMILES | ClC1C(Cl)C(Cl)C2NNNC2C1Cl |
| InChI | InChI=1S/C6H9Cl4N3/c7-1-2(8)4(10)6-5(3(1)9)11-13-12-6/h1-6,11-13H |
| InChIKey | CEGYWXPCYOKOFU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.97 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|