C12H22N2O3 — CID 170906239
methyl 2-amino-3-(5-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propanoate (PubChem CID 170906239) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is methyl 2-amino-3-(5-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-amino-3-(5-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 170906239 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | methyl 2-amino-3-(5-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(N)CC1CNC2CCC(O)CC12 |
| InChI | InChI=1S/C12H22N2O3/c1-17-12(16)10(13)4-7-6-14-11-3-2-8(15)5-9(7)11/h7-11,14-15H,2-6,13H2,1H3 |
| InChIKey | VRKOTADGCOLAMX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |