C7H13N3O3 — CID 170906454
5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ol (PubChem CID 170906454) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ol.
| Compound Name | 5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ol |
|---|---|
| PubChem CID | 170906454 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ol |
| SMILES | O=[N+]([O-])C1CCC2NNC(O)C2C1 |
| InChI | InChI=1S/C7H13N3O3/c11-7-5-3-4(10(12)13)1-2-6(5)8-9-7/h4-9,11H,1-3H2 |
| InChIKey | YONDKJUNFIKGQF-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|