About 5-phenyl-1,2,4-triazolidine-3-thiol
5-phenyl-1,2,4-triazolidine-3-thiol (PubChem CID 170906656) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 5-phenyl-1,2,4-triazolidine-3-thiol.
Molecular Properties
| Compound Name | 5-phenyl-1,2,4-triazolidine-3-thiol |
| PubChem CID | 170906656 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 5-phenyl-1,2,4-triazolidine-3-thiol |
| SMILES | SC1NNC(c2ccccc2)N1 |
| InChI | InChI=1S/C8H11N3S/c12-8-9-7(10-11-8)6-4-2-1-3-5-6/h1-5,7-12H |
| InChIKey | SOWRACXOLAYVID-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1,2,4-triazolidine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,2,4-triazolidine-3-thiol?
The IUPAC name of 5-phenyl-1,2,4-triazolidine-3-thiol (CID 170906656) is 5-phenyl-1,2,4-triazolidine-3-thiol.
What is the SMILES notation for 5-phenyl-1,2,4-triazolidine-3-thiol?
The canonical SMILES for 5-phenyl-1,2,4-triazolidine-3-thiol is SC1NNC(c2ccccc2)N1.
What is the InChIKey of 5-phenyl-1,2,4-triazolidine-3-thiol?
The InChIKey is SOWRACXOLAYVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c12-8-9-7(10-11-8)6-4-2-1-3-5-6/h1-5,7-12H.
What are the key properties of 5-phenyl-1,2,4-triazolidine-3-thiol?
5-phenyl-1,2,4-triazolidine-3-thiol has a molecular weight of 181.26 g/mol, XLogP of 0.60, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,2,4-triazolidine-3-thiol is sourced from PubChem (CID 170906656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).