C15H33ClN2O2 — CID 170906970
3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium chloride (PubChem CID 170906970) has the molecular formula C15H33ClN2O2 and a molecular weight of 308.89 g/mol. Its IUPAC name is 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium chloride.
| Compound Name | 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 170906970 |
| Molecular Formula | C15H33ClN2O2 |
| Molecular Weight | 308.89 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium chloride |
| SMILES | CC1(C)CC(OCCC[N+](C)(C)C)CC(C)(C)N1O.[Cl-] |
| InChI | InChI=1S/C15H33N2O2.ClH/c1-14(2)11-13(12-15(3,4)16(14)18)19-10-8-9-17(5,6)7;/h13,18H,8-12H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | DVMGCJSFKRKXFX-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.89 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|