C15H33N2O2+ — CID 170906971
3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium (PubChem CID 170906971) has the molecular formula C15H33N2O2+ and a molecular weight of 273.44 g/mol. Its IUPAC name is 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium.
| Compound Name | 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium |
|---|---|
| PubChem CID | 170906971 |
| Molecular Formula | C15H33N2O2+ |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl-trimethylazanium |
| SMILES | CC1(C)CC(OCCC[N+](C)(C)C)CC(C)(C)N1O |
| InChI | InChI=1S/C15H33N2O2/c1-14(2)11-13(12-15(3,4)16(14)18)19-10-8-9-17(5,6)7/h13,18H,8-12H2,1-7H3/q+1 |
| InChIKey | FFGCCJFJZRQREZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|